Systematic / IUPAC Name: 2-Oxobutanoic acid
ID: Reference180
Other Names:
3-Methylpyruvic acid;
Pyruvic acid, methyl-;
3-Methylpyruvate;
2-Ketobutyric acid;
α-Ketobutyric acid
; more
Formula: C4H6O3
Class: Endogenous Metabolites Excipients/Additives/Colorants
2-Oxobutyric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 72 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/9/2015 2:53:39 PM |
| InChI | InChI=1S/C4H6O3/c1-2-3(5)4(6)7/h2H2,1H3,(H,6,7) |
| InChI Key | TYEYBOSBBBHJIV-UHFFFAOYSA-N |
| Canonical SMILES | CCC(=O)C(=O)O |
| CAS | 600180 |
| Splash | |
| Other Names |
3-Methylpyruvic acid; Pyruvic acid, methyl-; 3-Methylpyruvate; 2-Ketobutyric acid; α-Ketobutyric acid; Butanoic acid, 2-oxo-; Butyric acid, 2-oxo-; α-Oxo-n-butyric acid; 2-Ketobutanoic acid; α-Oxobutyric acid; 2-Oxo-n-butyric acid; α-Ketobutyrate; α-Keto-n-butyric acid; α-Ketobutric acid; α-Oxobutyrate; 2-Ketobutanoate; 2-Oxo-n-butyrate; α-Oxo-n-butyrate; α-Keto-n-butyrate |
| ChemIDPlus | 002013265; 000600180; 099488752 |
| ChemSpider | 57 |
| PubChem | 58 |
| KEGG | C00109 |
| ChEMBL | CHEMBL171246 |
| Wikipedia | Alpha-Ketobutyric acid |
| ChEBI | CHEBI:30831 |
| HMDb | HMDB06544; HMDB06544; HMDB00005 |
| LipidsMAPs | LMFA01060002 |