Systematic / IUPAC Name: Ethyl 4-aminobenzoate
ID: Reference1803
Other Names:
Americaine;
Anaesthesin;
4-Aminobenzoic acid ethyl ester;
Amben ethyl ester;
Anesthesin
; more
Formula: C9H11NO2
Class: Therapeutics/Prescription Drugs
Benzocaine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/23/2014 1:02:56 PM |
| InChI | InChI=1S/C9H11NO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
| InChI Key | BLFLLBZGZJTVJG-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=CC=C(C=C1)N |
| CAS | 94097 |
| Splash | |
| Other Names |
Americaine; Anaesthesin; 4-Aminobenzoic acid ethyl ester; Amben ethyl ester; Anesthesin; Dermoplast; Ethoform; Hurricaine; Orthesin; Anaesthin; Anestezin; Anesthesine; Anesthone; Identhesin; Keloform; Norcaine; Parathesin; Parathesine; Topcaine; Norcain; Anaesthan-syngala; Ora-jel; p-Ethoxycarboxylic aniline; Solarcaine; Ethyl p-aminophenylcarboxylate; p-(Ethoxycarbonyl)aniline; 4-Carbethoxyaniline; Benzoic acid, 4-amino-, ethyl ester; Baby anbesol; 4-(Ethoxycarbonyl)aniline; Aethoform; p-Aminobenzoic acid ethyl ester; Benzoic acid, p-amino-, ethyl ester; Ethyl 4-aminobenzoate; Ethyl-p-aminobenzoate; Orabase-B; 4-(Ethoxycarbonyl)phenylamine; p-(Ethoxycarbonyl)phenylamine; Ethyl p-aminobenzenecarboxylate |
| PubChem | 2337 |
| KEGG | D00552; C07527 |
| ChEBI | CHEBI:116735 |
| Wikipedia | Benzocaine |
| ChemSpider | 13854242 |
| HMDb | HMDB04992 |
| ChEMBL | CHEMBL278172 |