Systematic / IUPAC Name: 2-Aminohexanoic acid
ID: Reference1823
Other Names:
Norleucine;
Norleucine, DL-;
2-Aminohexanoic acid, DL-;
α-Aminocaproic acid;
DL-α-Aminocaproic acid
Formula: C6H13NO2
DL-Norleucine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 123 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/7/2015 8:23:11 AM |
| InChI | InChI=1S/C6H13NO2/c1-2-3-4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9) |
| InChI Key | LRQKBLKVPFOOQJ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCC(C(=O)O)N |
| CAS | 616068 |
| Splash | |
| Other Names |
Norleucine; Norleucine, DL-; 2-Aminohexanoic acid, DL-; α-Aminocaproic acid; DL-α-Aminocaproic acid |
| Wikipedia | Norleucine |
| ChemIDPlus | 000327571; 000616068; 000327560 |
| PubChem | 9475; 517543 |
| ChemSpider | 9103 |
| ChEBI | CHEBI:36405 |