Systematic / IUPAC Name: (2S)-2-amino-4-[(2R)-2-amino-2-carboxyethyl]sulfanylbutanoic acid
ID: Reference1829
Other Names:
Cystathionine;
L-(+)-Cystathionine;
(R)-S-(2-Amino-2-carboxyethyl)-L-homocysteine;
L-Homocysteine, S-(2-amino-2-carboxyethyl)-, (R)-;
(2S)-2-Amino-4-{[(2R)-2-amino-2-carboxyethyl]sulfanyl}butanoic acid
; more
Formula: C7H14N2O4S
Class: Endogenous Metabolites
L-Cystathionine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 103 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/7/2015 10:03:25 AM |
| InChI | InChI=1S/C7H14N2O4S/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m0/s1 |
| InChI Key | ILRYLPWNYFXEMH-WHFBIAKZSA-N |
| Canonical SMILES | C(CSCC(C(=O)O)N)C(C(=O)O)N |
| CAS | 56882 |
| Splash | |
| Other Names |
Cystathionine; L-(+)-Cystathionine; (R)-S-(2-Amino-2-carboxyethyl)-L-homocysteine; L-Homocysteine, S-(2-amino-2-carboxyethyl)-, (R)-; (2S)-2-Amino-4-{[(2R)-2-amino-2-carboxyethyl]sulfanyl}butanoic acid; L-Homocysteine, S-[(2R)-2-amino-2-carboxyethyl]-; Butanoic acid, 2-amino-4-[(2-amino-2-carboxyethyl)thio]-, [R-(R*,S*)]-; S-[(2R)-2-Amino-2-carboxyethyl]-L-homocysteine; (2S)-2-Amino-4-{[(2R)-2-amino-2-carboxyethyl]thio}butanoic acid; [R-(R*,S*)]-2-Amino-4-[(2-amino-2-carboxyethyl)thio]-butanoic acid |
| KEGG | C02291 |
| HMDb | HMDB00099 |
| ChemSpider | 388392 |
| Wikipedia | Cystathionine |
| ChEBI | CHEBI:17482; CHEBI:58161 |
| PubChem | 439258 |