Systematic / IUPAC Name: 4-(2-Aminoethyl)-2-methoxyphenol
ID: Reference1846
Other Names:
3-O-Methyldopamine;
3-Methoxy-4-hydroxyphenylethyl amine;
Phenol, 4-(2-aminoethyl)-2-methoxy-
Formula: C9H13NO2
Class: Endogenous Metabolites
3-Methoxytyramine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 672 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/8/2015 8:43:21 AM |
| InChI | InChI=1S/C9H13NO2/c1-12-9-6-7(4-5-10)2-3-8(9)11/h2-3,6,11H,4-5,10H2,1H3 |
| InChI Key | DIVQKHQLANKJQO-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C=CC(=C1)CCN)O |
| CAS | |
| Splash | |
| Other Names |
3-O-Methyldopamine; 3-Methoxy-4-hydroxyphenylethyl amine; Phenol, 4-(2-aminoethyl)-2-methoxy- |
| ChemIDPlus | 001477685 |
| HMDb | HMDB00022 |
| ChEMBL | CHEMBL1160785 |
| KEGG | C05587 |
| ChemSpider | 1606 |
| Wikipedia | 3-Methoxytyramine |
| PubChem | 1669 |