Systematic / IUPAC Name: (6β,11β)-6,11,17,21-Tetrahydroxypregn-4-ene-3,20-dione
ID: Reference1854
Other Names:
(6R,8S,9S,10R,11S,13S,14S,17R)-6,11,17-Trihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one;
6β,11β,17α,21-Tetrahydroxypregn-4-en-3,20-dione;
6β,17-Dihydroxycorticosterone;
Corticosterone, 6β,17-dihydroxy-;
Pregn-4-en-3,20-dione, 6,11,17,21-tetrahydroxy-, (6β,11β)-
Formula: C21H30O6
Class: Endogenous Metabolites
6 β-Hydroxycortisol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 5020 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 12/15/2016 11:49:32 AM |
| InChI | InChI=1S/C21H30O6/c1-19-5-3-11(23)7-14(19)15(24)8-12-13-4-6-21(27,17(26)10-22)20(13,2)9-16(25)18(12)19/h7,12-13,15-16,18,22,24-25,27H,3-6,8-10H2,1-2H3/t12-,13-,15+,16-,18+,19-,20-,21-/m0/s1 |
| InChI Key | GNFTWPCIRXSCQF-UJXAPRPESA-N |
| Canonical SMILES | CC12CCC(=O)C=C1C(CC3C2C(CC4(C3CCC4(C(=O)CO)O)C)O)O |
| CAS | |
| Splash | |
| Other Names |
(6R,8S,9S,10R,11S,13S,14S,17R)-6,11,17-Trihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one; 6β,11β,17α,21-Tetrahydroxypregn-4-en-3,20-dione; 6β,17-Dihydroxycorticosterone; Corticosterone, 6β,17-dihydroxy-; Pregn-4-en-3,20-dione, 6,11,17,21-tetrahydroxy-, (6β,11β)-; Pregn-4-ene-3,20-dione, 6β,11β,17,21-tetrahydroxy- |
| ChemSpider | 5254712 |
| PubChem | 6852390 |
| ChEMBL | CHEMBL1389133 |