Systematic / IUPAC Name: 2-Amino-2-(3,5-dihydroxyphenyl)acetic acid
ID: Reference188
Other Names:
Amino(3,5-dihydroxyphenyl)acetic acid;
α-Amino-3,5-dihydroxybenzeneacetic acid;
Benzeneacetic acid, α-amino-3,5-dihydroxy-;
3,5-DHPG
Formula: C8H9NO4
Class: Endogenous Metabolites
3,5-Dihydroxyphenylglycine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 199 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/10/2016 12:58:39 PM |
| InChI | InChI=1S/C8H9NO4/c9-7(8(12)13)4-1-5(10)3-6(11)2-4/h1-3,7,10-11H,9H2,(H,12,13) |
| InChI Key | HOOWCUZPEFNHDT-UHFFFAOYSA-N |
| Canonical SMILES | C1=C(C=C(C=C1O)O)C(C(=O)O)N |
| CAS | 146255665 |
| Splash | |
| Other Names |
Amino(3,5-dihydroxyphenyl)acetic acid; α-Amino-3,5-dihydroxybenzeneacetic acid; Benzeneacetic acid, α-amino-3,5-dihydroxy-; 3,5-DHPG |
| ChEMBL | CHEMBL66105 |
| Wikipedia | Dihydroxyphenylglycine |
| ChemSpider | 97113 |
| PubChem | 108001 |
| ChemIDPlus | 146255665 |