Systematic / IUPAC Name: 7-(10,11-Dihydro-5H-dibenzo[a,d-][7]annulen-5-ylamino)heptanoic acid
ID: Reference1880
Other Names:
Amineptin;
7-((10,11-Dihydro-5H-dibenzo(a,d-)cyclohepten-5-yl)amino)heptanoic acid;
7-(10,11-Dihydro-5H-dibenzo[a,d-]cyclohepten-5-ylamino)heptanoic acid;
Heptanoic acid, 7-((10,11-dihydro-5H-dibenzo(a,d-)cyclohepten-5-YL)amino)-;
7-[(10,11-Dihydro-5H-dibenzo[a,d-]cyclohepten-5-yl)amino]heptanoic acid
Formula: C22H27NO2
Class: Therapeutics/Prescription Drugs
Amineptine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 39 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/8/2015 11:07:06 AM |
| InChI | InChI=1S/C22H27NO2/c24-21(25)13-3-1-2-8-16-23-22-19-11-6-4-9-17(19)14-15-18-10-5-7-12-20(18)22/h4-7,9-12,22-23H,1-3,8,13-16H2,(H,24,25) |
| InChI Key | ONNOFKFOZAJDHT-UHFFFAOYSA-N |
| Canonical SMILES | C1CC2=CC=CC=C2C(C3=CC=CC=C31)NCCCCCCC(=O)O |
| CAS | 57574091 |
| Splash | |
| Other Names |
Amineptin; 7-((10,11-Dihydro-5H-dibenzo(a,d-)cyclohepten-5-yl)amino)heptanoic acid; 7-(10,11-Dihydro-5H-dibenzo[a,d-]cyclohepten-5-ylamino)heptanoic acid; Heptanoic acid, 7-((10,11-dihydro-5H-dibenzo(a,d-)cyclohepten-5-YL)amino)-; 7-[(10,11-Dihydro-5H-dibenzo[a,d-]cyclohepten-5-yl)amino]heptanoic acid |
| ChemSpider | 32091 |
| ChemIDPlus | 057574091 |
| Wikipedia | Amineptine |
| ChEBI | CHEBI:32499 |
| KEGG | D07335 |
| ChEMBL | CHEMBL418995 |
| PubChem | 34870 |