Systematic / IUPAC Name: 6-Methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol
ID: Reference1886
Other Names:
6a-β-Aporphine-10,11-diol;
4H-Dibenzo[de,g]quinoline-10,11-diol, 5,6,6a,7-tetrahydro-6-methyl-
Formula: C17H17NO2
Class: Therapeutics/Prescription Drugs
Apomorphine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 39 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/16/2015 11:14:49 AM |
| InChI | InChI=1S/C17H17NO2/c1-18-8-7-10-3-2-4-12-15(10)13(18)9-11-5-6-14(19)17(20)16(11)12/h2-6,13,19-20H,7-9H2,1H3 |
| InChI Key | VMWNQDUVQKEIOC-UHFFFAOYSA-N |
| Canonical SMILES | CN1CCC2=CC=CC3=C2C1CC4=C3C(=C(C=C4)O)O |
| CAS | 41372207 |
| Splash | |
| Other Names |
6a-β-Aporphine-10,11-diol; 4H-Dibenzo[de,g]quinoline-10,11-diol, 5,6,6a,7-tetrahydro-6-methyl- |
| ChEMBL | CHEMBL70099 |
| Wikipedia | Apomorphine |
| PubChem | 2215 |
| ChemSpider | 2129 |