Systematic / IUPAC Name: 3-Amino-3-(4-hydroxyphenyl)propanoic acid
ID: Reference190
Other Names:
3-Amino-3-(4-hydroxyphenyl)propionic acid;
Propanoic acid, 3-amino-3-(4-hydroxyphenyl)-
Formula: C9H11NO3
Class: Endogenous Metabolites
3-Amino-3-(4-hydroxyphenyl)propanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 792 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 11/18/2014 7:39:06 AM |
| InChI | InChI=1S/C9H11NO3/c10-8(5-9(12)13)6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13) |
| InChI Key | JYPHNHPXFNEZBR-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1C(CC(=O)O)N)O |
| CAS | 6049543 |
| Splash | |
| Other Names |
3-Amino-3-(4-hydroxyphenyl)propionic acid; Propanoic acid, 3-amino-3-(4-hydroxyphenyl)- |
| KEGG | C04368 |
| ChEBI | CHEBI:16939; CHEBI:57956 |
| ChemSpider | 389285 |
| HMDb | HMDB03831 |
| PubChem | 440311; 4357428 |