Systematic / IUPAC Name: {3-[(1-Ethoxy-1-oxo-4-phenyl-2-butanyl)amino]-2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl}acetic acid
ID: Reference1900
Other Names:
{3-[(1-Ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl}acetic acid;
1H-1-Benzazepine-1-acetic acid, 3-[[1-(ethoxycarbonyl)-3-phenylpropyl]amino]-2,3,4,5-tetrahydro-2-oxo-
Formula: C24H28N2O5
Class: Therapeutics/Prescription Drugs
Benazepril mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 39 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/15/2015 3:50:42 PM |
| InChI | InChI=1S/C24H28N2O5/c1-2-31-24(30)20(14-12-17-8-4-3-5-9-17)25-19-15-13-18-10-6-7-11-21(18)26(23(19)29)16-22(27)28/h3-11,19-20,25H,2,12-16H2,1H3,(H,27,28) |
| InChI Key | XPCFTKFZXHTYIP-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C(CCC1=CC=CC=C1)NC2CCC3=CC=CC=C3N(C2=O)CC(=O)O |
| CAS | |
| Splash | |
| Other Names |
{3-[(1-Ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl}acetic acid; 1H-1-Benzazepine-1-acetic acid, 3-[[1-(ethoxycarbonyl)-3-phenylpropyl]amino]-2,3,4,5-tetrahydro-2-oxo- |
| PubChem | 2311 |
| ChEMBL | CHEMBL1604571 |
| Wikipedia | Benazepril |
| ChemSpider | 2221 |