Systematic / IUPAC Name: 9-(3-O-Phosphonopentofuranosyl)-9H-purin-6-amine
ID: Reference194
Other Names:
{[(2R,3S,4R,5R)-5-(6-Amino-9H-purin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy}phosphonic acid;
Synadenylic acid;
3'-Adenylic acid;
Adenosine-3'-phosphoric acid;
3'-AMP
; more
Formula: C10H14N5O7P
Class: Endogenous Metabolites
3'-Adenosine monophosphate (3'-AMP) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 200 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/18/2014 10:59:44 AM |
| InChI | InChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(17)7(4(1-16)21-10)22-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
| InChI Key | LNQVTSROQXJCDD-KQYNXXCUSA-N |
| Canonical SMILES | O=P(O)(O)OC3C(OC(n2cnc1c(ncnc12)N)C3O)CO |
| CAS | 84219 |
| Splash | |
| Other Names |
{[(2R,3S,4R,5R)-5-(6-Amino-9H-purin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy}phosphonic acid; Synadenylic acid; 3'-Adenylic acid; Adenosine-3'-phosphoric acid; 3'-AMP; 3'-Adenosine monophosphate; Adenosine 3'-monophosphate |
| HMDb | HMDB03540 |
| ChemSpider | 224592; 21232460; 21234090 |
| KEGG | C01367 |
| PubChem | 41211 |
| ChEMBL | CHEMBL576739 |
| ChEBI | CHEBI:28931 |
| ChemIDPlus | 054835813; 000084219 |