Systematic / IUPAC Name: S-{[(4-Chlorophenyl)sulfanyl]methyl} O,O-diethyl phosphorodithioate
ID: Reference1959
Other Names:
Carbofenotion;
Carbofenothion;
Carbofenthion;
Oleoakarithion;
Acarithion
; more
Formula: C11H16ClO2PS3
Class: Pesticides/Herbicides
Carbophenothion mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 838 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/14/2015 11:12:40 AM |
| InChI | InChI=1S/C11H16ClO2PS3/c1-3-13-15(16,14-4-2)18-9-17-11-7-5-10(12)6-8-11/h5-8H,3-4,9H2,1-2H3 |
| InChI Key | VEDTXTNSFWUXGQ-UHFFFAOYSA-N |
| Canonical SMILES | CCOP(=S)(OCC)SCSC1=CC=C(C=C1)Cl |
| CAS | 786196 |
| Splash | |
| Other Names |
Carbofenotion; Carbofenothion; Carbofenthion; Oleoakarithion; Acarithion; Garrathion; Hexathion; Trithion; Ethyl carbophenothion; Akarithion; Dagadip; Nephocarp; Trithion miticide; Lethox; Endyl; O,O-Diethyl dithiophosphoric acid p-chlorophenylthiomethyl ester; O,O-Diethyl S-p-chlorophenylthiomethyl dithiophosphate; O,O-Diethyl S-(4-chlorophenylthiomethyl) dithiophosphate; S-(4-Chlorophenylthiomethyl)diethyl phosphorothiolothionate; S-[(p-Chlorophenylthio)methyl] O,O-diethyl phosphorodithioate; S-{[(4-Chlorophenyl)thio]methyl} O,O-diethyl dithiophosphate; S-{[(p-Chlorophenyl)thio]methyl} O,O-diethyl phosphorodithioate; Phosphorodithioic acid, S-(((p-chlorophenyl)thio)methyl) O,O-diethyl ester; Karbofenothion; Phosphorodithioic acid, S-[[(4-chlorophenyl)thio]methyl] O,O-diethyl ester; S-(4-Chlorophenylthiomethyl) O,O-diethyl phosphorodithioate; S-{[(4-Chlorophenyl)thio]methyl}diethyl phosphorothiolothionate; (4-Chlorophenyl)sulfanylmethylsulfanyl-diethoxy-sulfanylidenephosphorane; Phosphorodithioic acid S-{[(4-chlorophenyl)thio]methyl} O,O-diethyl ester |
| PubChem | 13081 |
| ChemIDPlus | 000786196 |
| Wikipedia | Carbophenothion |
| KEGG | C18968 |
| ChEMBL | CHEMBL452866 |
| ChemSpider | 12536 |