Systematic / IUPAC Name: 2-Amino-3-hydroxybenzoic acid
ID: Reference198
Other Names:
Benzoic acid, 2-amino-3-hydroxy-;
Anthranilic acid, 3-hydroxy-;
2-Amino-3-hydroxy-benzoic acid;
3-Hydroxy anthranilic acid;
3-Hydroxy-2-aminobenzoate
; more
Formula: C7H7NO3
Class: Endogenous Metabolites
3-Hydroxyanthranilic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 294 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/19/2014 10:17:27 AM |
| InChI | InChI=1S/C7H7NO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3,9H,8H2,(H,10,11) |
| InChI Key | WJXSWCUQABXPFS-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C(=C1)O)N)C(=O)O |
| CAS | 548936 |
| Splash | |
| Other Names |
Benzoic acid, 2-amino-3-hydroxy-; Anthranilic acid, 3-hydroxy-; 2-Amino-3-hydroxy-benzoic acid; 3-Hydroxy anthranilic acid; 3-Hydroxy-2-aminobenzoate; 3-Hydroxy-2-aminobenzoic acid; 3-Oxyanthranilic acid; 3-OHAA |
| ChemSpider | 84 |
| ChEMBL | CHEMBL445304 |
| Wikipedia | 3-Hydroxyanthranilic acid |
| ChEBI | CHEBI:15793 |
| PubChem | 86 |
| KEGG | C00632 |
| ChemIDPlus | 000548936; 002375077; 004920814 |
| HMDb | HMDB01476; HMDB01476 |