Systematic / IUPAC Name: 4-[(4-Chlorobenzoyl)(4-methoxyphenyl)amino]butanoic acid
ID: Reference1983
Other Names:
Clanobutine;
Bykahepar;
4-(p-Chloro-N-(p-methoxyphenyl)benzamido)butyric acid;
4-((4-Chlorobenzoyl)(4-methoxyphenyl)amino)butanoic acid;
Butyric acid, 4-(p-chloro-N-(p-methoxyphenyl)benzamido)-
; more
Formula: C18H18ClNO4
Class: Therapeutics/Prescription Drugs
Clanobutin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/13/2015 12:43:31 PM |
| InChI | InChI=1S/C18H18ClNO4/c1-24-16-10-8-15(9-11-16)20(12-2-3-17(21)22)18(23)13-4-6-14(19)7-5-13/h4-11H,2-3,12H2,1H3,(H,21,22) |
| InChI Key | VUPBWNXFSDRWJE-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)N(CCCC(=O)O)C(=O)C2=CC=C(C=C2)Cl |
| CAS | |
| Splash | |
| Other Names |
Clanobutine; Bykahepar; 4-(p-Chloro-N-(p-methoxyphenyl)benzamido)butyric acid; 4-((4-Chlorobenzoyl)(4-methoxyphenyl)amino)butanoic acid; Butyric acid, 4-(p-chloro-N-(p-methoxyphenyl)benzamido)-; Butanoic acid, 4-[(4-chlorobenzoyl)(4-methoxyphenyl)amino]-; N-(p-Chlorobenzoyl)-Υ-(p-anisidino) butyric acid |