Systematic / IUPAC Name: 1-(4-chlorophenyl)-4-(dimethylamino)-2,3-dimethylbutan-2-ol
ID: Reference1990
Other Names:
4-Chloro-α(2-(dimethylamino)-1-methylethyl)α-methylbenzeneethanol;
1-(4-Chlorophenyl)-2,3-dimethyl-4-dimethylamino-2-butanol;
Benzeneethanol, 4-chloro-α-(2-(dimethylamino)-1-methyl)-α-methyl-;
p-Chloro-α-(2-(dimethylamino)-1-methylethyl)-α-methylphenethyl alcohol;
Phenethyl alcohol, p-chloro-α-(2-(dimethylamino)-1-methylethyl)-α-methyl-
Formula: C14H22ClNO
Class: Therapeutics/Prescription Drugs
Clobutinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/13/2015 10:47:57 AM |
| InChI | InChI=1S/C14H22ClNO/c1-11(10-16(3)4)14(2,17)9-12-5-7-13(15)8-6-12/h5-8,11,17H,9-10H2,1-4H3 |
| InChI Key | KVHHQGIIZCJATJ-UHFFFAOYSA-N |
| Canonical SMILES | CC(CN(C)C)C(C)(CC1=CC=C(C=C1)Cl)O |
| CAS | 14860492 |
| Splash | |
| Other Names |
4-Chloro-α(2-(dimethylamino)-1-methylethyl)α-methylbenzeneethanol; 1-(4-Chlorophenyl)-2,3-dimethyl-4-dimethylamino-2-butanol; Benzeneethanol, 4-chloro-α-(2-(dimethylamino)-1-methyl)-α-methyl-; p-Chloro-α-(2-(dimethylamino)-1-methylethyl)-α-methylphenethyl alcohol; Phenethyl alcohol, p-chloro-α-(2-(dimethylamino)-1-methylethyl)-α-methyl- |
| Wikipedia | Clobutinol |
| KEGG | D07716 |
| PubChem | 26937 |
| ChemSpider | 25085 |
| ChEMBL | CHEMBL1474889 |
| ChemIDPlus | 014860492 |