Systematic / IUPAC Name: 2-Hydroxy-3-propan-2-ylbutanedioic acid
ID: Reference204
Other Names:
2-Hydroxy-3-isopropylsuccinic acid;
3-Carboxy-2-hydroxy-4-methylpentanoic acid;
2-Hydroxy-3-(propan-2-yl)butanedioic acid;
Butanedioic acid, 2-hydroxy-3-(1-methylethyl)-
Formula: C7H12O5
Class: Endogenous Metabolites
3-Isopropylmalic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 142 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/20/2014 8:09:44 AM |
| InChI | InChI=1S/C7H12O5/c1-3(2)4(6(9)10)5(8)7(11)12/h3-5,8H,1-2H3,(H,9,10)(H,11,12) |
| InChI Key | RNQHMTFBUSSBJQ-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)C(C(C(=O)O)O)C(=O)O |
| CAS | 16048898 |
| Splash | |
| Other Names |
2-Hydroxy-3-isopropylsuccinic acid; 3-Carboxy-2-hydroxy-4-methylpentanoic acid; 2-Hydroxy-3-(propan-2-yl)butanedioic acid; Butanedioic acid, 2-hydroxy-3-(1-methylethyl)- |
| Wikipedia | Isopropylmalic acid |
| PubChem | 36 |
| ChemSpider | 35; 21231992; 21232128 |
| ChEBI | CHEBI:35114 |