Systematic / IUPAC Name: N-[(1S)-1-Carboxy-3-phenylpropyl]alanyl-L-proline
ID: Reference2073
Other Names:
Enalaprilate;
Enalapril acid;
Enalaprilat dihydrate;
Enalapril diacid;
Enalaprilat anhydrous
; more
Formula: C18H24N2O5
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
Enalaprilat mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/23/2015 7:52:15 AM |
| InChI | InChI=1S/C18H24N2O5/c1-12(16(21)20-11-5-8-15(20)18(24)25)19-14(17(22)23)10-9-13-6-3-2-4-7-13/h2-4,6-7,12,14-15,19H,5,8-11H2,1H3,(H,22,23)(H,24,25)/t12-,14-,15-/m0/s1 |
| InChI Key | LZFZMUMEGBBDTC-QEJZJMRPSA-N |
| Canonical SMILES | CC(C(=O)N1CCCC1C(=O)O)NC(CCC2=CC=CC=C2)C(=O)O |
| CAS | 76420729 |
| Splash | |
| Other Names |
Enalaprilate; Enalapril acid; Enalaprilat dihydrate; Enalapril diacid; Enalaprilat anhydrous; 1-((2S)-2-{[(1S)-1-Carboxy-3-phenylpropyl]amino}propanoyl)-L-proline; EAL |
| Wikipedia | Enalaprilat |
| ChEMBL | CHEMBL577 |
| PubChem | 5462501 |
| ChemSpider | 4575429 |
| HMDb | HMDB41886 |
| KEGG | C11720 |
| ChEBI | CHEBI:4786 |