Systematic / IUPAC Name: (1S)-1-[3-(Dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile
ID: Reference2080
Other Names:
(S)-Citalopram;
S(+)-Citalopram;
(+)-Citalopram;
(1S)-1-[3-(Dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile;
5-Isobenzofurancarbonitrile, 1-(3-(dimethylamino)propyl)-1-(4-fluorophenyl)-1,3-dihydro-, (1S)-
Formula: C20H21FN2O
Class: Therapeutics/Prescription Drugs
Escitalopram mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 762 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/23/2015 1:58:38 PM |
| InChI | InChI=1S/C20H21FN2O/c1-23(2)11-3-10-20(17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-24-20/h4-9,12H,3,10-11,14H2,1-2H3/t20-/m0/s1 |
| InChI Key | WSEQXVZVJXJVFP-FQEVSTJZSA-N |
| Canonical SMILES | CN(C)CCCC1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)F |
| CAS | 128196010 |
| Splash | |
| Other Names |
(S)-Citalopram; S(+)-Citalopram; (+)-Citalopram; (1S)-1-[3-(Dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile; 5-Isobenzofurancarbonitrile, 1-(3-(dimethylamino)propyl)-1-(4-fluorophenyl)-1,3-dihydro-, (1S)-; (1S)-1-[3-(Dimethylamino)propyl]-1-(4-fluorophenyl)-3H-isobenzofuran-5-carbonitrile |
| ChemIDPlus | 128196010 |
| PubChem | 146570 |
| DrugBank | DB01175 |
| HMDb | HMDB05028 |
| Wikipedia | Escitalopram |
| ChEMBL | CHEMBL1508 |
| ChEBI | CHEBI:36791 |
| ChemSpider | 129277 |
| KEGG | D07913 |