Systematic / IUPAC Name: 4-(Aminomethyl)cyclohexane-1-carboxylic acid
ID: Reference2095
Other Names:
4-(Aminomethyl)cyclohexanecarboxylic acid;
Cyclohexanecarboxylic acid, 4-(aminomethyl)-
Formula: C8H15NO2
Class: Therapeutics/Prescription Drugs
Tranexamic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/26/2015 11:14:22 AM |
| InChI | InChI=1S/C8H15NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h6-7H,1-5,9H2,(H,10,11) |
| InChI Key | GYDJEQRTZSCIOI-UHFFFAOYSA-N |
| Canonical SMILES | C1CC(CCC1CN)C(=O)O |
| CAS | 1197188 |
| Splash | |
| Other Names |
4-(Aminomethyl)cyclohexanecarboxylic acid; Cyclohexanecarboxylic acid, 4-(aminomethyl)- |
| PubChem | 5526 |
| ChEMBL | CHEMBL292500 |
| Wikipedia | Tranexamic acid |
| ChemSpider | 5325 |
| KEGG | D01136 |
| ChemIDPlus | 001197188; 000701542; 001197177 |