Systematic / IUPAC Name: 2-Phenyl-1,3-propanediyl dicarbamate
ID: Reference2101
Other Names:
Felbamyl;
2-Phenyl-1,3-propanediol dicarbamate;
2-Phenylpropane-1,3-diyl dicarbamate;
Taloxa;
1,3-Propanediol, 2-phenyl-, dicarbamate
; more
Formula: C11H14N2O4
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
Felbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/26/2015 3:46:38 PM |
| InChI | InChI=1S/C11H14N2O4/c12-10(14)16-6-9(7-17-11(13)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,12,14)(H2,13,15) |
| InChI Key | WKGXYQFOCVYPAC-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(COC(=O)N)COC(=O)N |
| CAS | 25451154 |
| Splash | |
| Other Names |
Felbamyl; 2-Phenyl-1,3-propanediol dicarbamate; 2-Phenylpropane-1,3-diyl dicarbamate; Taloxa; 1,3-Propanediol, 2-phenyl-, dicarbamate; Carbamic acid, 2-phenyltrimethylene ester; 3-(Carbamoyloxy)-2-phenylpropyl carbamate |
| Wikipedia | Felbamate |
| PubChem | 3331 |
| DrugBank | DB00949 |
| KEGG | C07501; D00536 |
| ChEMBL | CHEMBL1094 |
| HMDb | HMDB15084 |
| ChemSpider | 3214 |
| ChemIDPlus | 025451154 |
| ChEBI | CHEBI:4995 |