Systematic / IUPAC Name: 3-Methylpentanedioic acid
ID: Reference211
Other Names:
Methylglutaric acid;
β-Methylglutaric acid;
Pentanedioic acid, 3-methyl-;
3-Methylpentanedioate;
Methylglutarate
; more
Formula: C6H10O4
Class: Endogenous Metabolites
3-Methylglutaric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 1033 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 11/20/2014 10:48:41 AM |
| InChI | InChI=1S/C6H10O4/c1-4(2-5(7)8)3-6(9)10/h4H,2-3H2,1H3,(H,7,8)(H,9,10) |
| InChI Key | XJMMNTGIMDZPMU-UHFFFAOYSA-N |
| Canonical SMILES | CC(CC(=O)O)CC(=O)O |
| CAS | 626517 |
| Splash | |
| Other Names |
Methylglutaric acid; β-Methylglutaric acid; Pentanedioic acid, 3-methyl-; 3-Methylpentanedioate; Methylglutarate; 3-Methylglutarate; β-Methylglutarate; 3-Methyl glutaric acid; 3-Methylpentane-1,5-dioic acid |
| PubChem | 12284 |
| ChEBI | CHEBI:68566 |
| ChemSpider | 11781 |
| HMDb | HMDB00752 |
| ChemIDPlus | 000626517 |