Systematic / IUPAC Name: 1-(tert-Butylamino)-3-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol
ID: Reference2114
Other Names:
1-(tert-Butylamino)-3-[(4-morpholino-1,2,5-thiadiazol-3-yl)oxy]-2-propanol;
Timololo;
Timacar depot;
(1)-1-(tert-Butylamino)-3-[(4-(morpholin-4-yl)-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol
Formula: C13H24N4O3S
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
Timolol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 112 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/27/2015 1:49:27 PM |
| InChI | InChI=1S/C13H24N4O3S/c1-13(2,3)14-8-10(18)9-20-12-11(15-21-16-12)17-4-6-19-7-5-17/h10,14,18H,4-9H2,1-3H3 |
| InChI Key | BLJRIMJGRPQVNF-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)NCC(COC1=NSN=C1N2CCOCC2)O |
| CAS | 26839758 |
| Splash | |
| Other Names |
1-(tert-Butylamino)-3-[(4-morpholino-1,2,5-thiadiazol-3-yl)oxy]-2-propanol; Timololo; Timacar depot; (1)-1-(tert-Butylamino)-3-[(4-(morpholin-4-yl)-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol |
| ChEMBL | CHEMBL173706 |
| ChEBI | CHEBI:39465 |
| ChemIDPlus | 029023481; 047148572; 050929981; 057073559 |
| Wikipedia | Timolol |
| ChemSpider | 5278 |
| PubChem | 5478 |
| DrugBank | DB00373 |