Systematic / IUPAC Name: 2-Amino-3-(3-methylimidazol-4-yl)propanoic acid
ID: Reference213
Other Names:
2-Amino-3-(1-methyl-1H-imidazol-5-yl)propanoic acid;
2-Amino-3-(3-methyl-4-imidazolyl)propanoic acid;
2-Azanyl-3-(3-methylimidazol-4-yl)propanoic acid
Formula: C7H11N3O2
Class: Endogenous Metabolites
3-Methylhistidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 4 |
| No. of Spectra | 1321 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 11/20/2014 11:37:52 AM |
| InChI | InChI=1S/C7H11N3O2/c1-10-4-9-3-5(10)2-6(8)7(11)12/h3-4,6H,2,8H2,1H3,(H,11,12) |
| InChI Key | JDHILDINMRGULE-UHFFFAOYSA-N |
| Canonical SMILES | CN1C=NC=C1CC(C(=O)O)N |
| CAS | 368161 |
| Splash | |
| Other Names |
2-Amino-3-(1-methyl-1H-imidazol-5-yl)propanoic acid; 2-Amino-3-(3-methyl-4-imidazolyl)propanoic acid; 2-Azanyl-3-(3-methylimidazol-4-yl)propanoic acid |
| ChEBI | CHEBI:70959 |
| ChemSpider | 491986 |
| PubChem | 565965 |
| KEGG | C01152 |