Systematic / IUPAC Name: 2,6-Dichloro-N-{[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl}benzamide
ID: Reference2140
Other Names: 2,6-Dichloro-N-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]methyl}benzamide
Formula: C14H8Cl3F3N2O
Class: Pesticides/Herbicides
Fluopicolide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 934 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/29/2015 3:47:51 PM |
| InChI | InChI=1S/C14H8Cl3F3N2O/c15-8-2-1-3-9(16)12(8)13(23)22-6-11-10(17)4-7(5-21-11)14(18,19)20/h1-5H,6H2,(H,22,23) |
| InChI Key | GBOYJIHYACSLGN-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C(=C1)Cl)C(=O)NCC2=C(C=C(C=N2)C(F)(F)F)Cl)Cl |
| CAS | 239110157 |
| Splash | |
| Other Names | 2,6-Dichloro-N-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]methyl}benzamide |
| KEGG | C18464 |
| ChemSpider | 9334122 |
| Wikipedia | Fluopicolide |
| PubChem | 11159021 |