Systematic / IUPAC Name: 2,2-Dichloro-N-{(1R,2R)-1,3-dihydroxy-1-[4-(methylsulfonyl)phenyl]-2-propanyl}acetamide
ID: Reference2149
Other Names:
Thiophenicol;
Dextrosulphenidol;
Thiamcol;
(+)-Thiamphenicol;
Macphenicol
; more
Formula: C12H15Cl2NO5S
Class: Therapeutics/Prescription Drugs Excipients/Additives/Colorants
Thiamphenicol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP ; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 1955 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/30/2015 11:48:10 AM |
| InChI | InChI=1S/C12H15Cl2NO5S/c1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-16)15-12(18)11(13)14/h2-5,9-11,16-17H,6H2,1H3,(H,15,18)/t9-,10-/m1/s1 |
| InChI Key | OTVAEFIXJLOWRX-NXEZZACHSA-N |
| Canonical SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(C(CO)NC(=O)C(Cl)Cl)O |
| CAS | 15318453 |
| Splash | |
| Other Names |
Thiophenicol; Dextrosulphenidol; Thiamcol; (+)-Thiamphenicol; Macphenicol; Urfamicina; Urfamycine; Descocin; Dexawin; Efnicol; Hyrazin; Igralin; Masatirin; Neomyson; Rincrol; D-Thiophenicol; D-Thiocymetin; Unaseran-D; Methylsulfonylchloramphenicol; Raceophenidol; Urophenyl; 2,2-Dichloro-N-{(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-[4-(methylsulfonyl)phenyl]ethyl}acetamide; D-(+)-Threo-2,2-dichloro-N-(β-hydroxy-α-(hydroxymethyl)-p-(methylsulfonyl)phenethyl)acetamide; Vicemycetin; Dextrosulfenidol; D-d-Threo-2-dichloroacetamido-1-(4-methylsulfonylphenyl)-1,3-propanediol; D-Threo-(1R,2R)-1-(p-methylsulfonylphenyl)-2-dichloroacetamido-1,3-propanediol; Acetamide, 2,2-dichloro-N-((1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-(methylsulfonyl)phenyl)ethyl)-; Acetamide, 2,2-dichloro-N-(β-hydroxy-α-(hydroxymethyl)-p-(methylsulfonyl)phenethyl), D-threo-(+); 2,2-Dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methanesulfonylphenyl)propan-2-yl]acetamide; D-Threo-2,2-dichloro-N-(β-hydroxy-α-[hydroxymethyl]-4-[methylsulfonyl]phenethyl)acetamide |
| KEGG | C12853; D01407 |
| ChEBI | CHEBI:32215 |
| ChemIDPlus | 015318453 |
| Wikipedia | Thiamphenicol |
| DrugBank | DB08621 |
| PubChem | 27200 |
| ChemSpider | 25315 |
| ChEMBL | CHEMBL1236282 |