Systematic / IUPAC Name: 5-(Methylamino)-2-phenyl-4-[3-(trifluoromethyl)phenyl]furan-3-one
ID: Reference2152
Other Names:
Benchmark;
3(2H)-Furanone, 5-(methylamino)-2-phenyl-4-[3-(trifluoromethyl)phenyl]-;
5-(Methylamino)-2-phenyl-4-[3-(trifluoromethyl)phenyl]furan-3(2H)-one
Formula: C18H14F3NO2
Class: Pesticides/Herbicides
Flurtamone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 5109 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 2/2/2015 10:52:08 AM |
| InChI | InChI=1S/C18H14F3NO2/c1-22-17-14(12-8-5-9-13(10-12)18(19,20)21)15(23)16(24-17)11-6-3-2-4-7-11/h2-10,16,22H,1H3 |
| InChI Key | NYRMIJKDBAQCHC-UHFFFAOYSA-N |
| Canonical SMILES | CNC1=C(C(=O)C(O1)C2=CC=CC=C2)C3=CC(=CC=C3)C(F)(F)F |
| CAS | 96525234 |
| Splash | |
| Other Names |
Benchmark; 3(2H)-Furanone, 5-(methylamino)-2-phenyl-4-[3-(trifluoromethyl)phenyl]-; 5-(Methylamino)-2-phenyl-4-[3-(trifluoromethyl)phenyl]furan-3(2H)-one |
| ChemSpider | 82853 |
| ChemIDPlus | 096525234 |
| ChEMBL | CHEMBL1863061 |
| PubChem | 91755 |