Systematic / IUPAC Name: 3-Hydroxy-N-phenyl-N-piperidin-4-ylpropanamide
ID: Reference2158
Other Names: Propanamide, 3-hydroxy-N-phenyl-N-4-piperidinyl-
Formula: C14H20N2O2
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs Sports Doping Drugs
ω-Hydroxynorfentanyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/15/2020 5:17:54 AM |
| InChI | InChI=1S/C14H20N2O2/c17-11-8-14(18)16(12-4-2-1-3-5-12)13-6-9-15-10-7-13/h1-5,13,15,17H,6-11H2 |
| InChI Key | ODJQWAPHOXFBAG-UHFFFAOYSA-N |
| Canonical SMILES | C1CNCCC1N(C2=CC=CC=C2)C(=O)CCO |
| CAS | |
| Splash | |
| Other Names | Propanamide, 3-hydroxy-N-phenyl-N-4-piperidinyl- |