Systematic / IUPAC Name: N-[(3-Hydroxy-4,7,7-trimethylbicyclo[2.2.1]hept-2-yl)carbamoyl]-4-methylbenzenesulfonamide
ID: Reference2161
Other Names:
1-((1R)-2-Endo-hydroxy-3-endo-bornyl)-3-(p-tolylsulfonyl)urea;
Urea, 1-(2-hydroxy-3-bornyl)-3-(p-tolylsulfonyl), (1R,2R,3S,4S)-;
N-{[(3-Hydroxy-4,7,7-trimethylbicyclo[2.2.1]hept-2-yl)amino]carbonyl}-4-methylbenzenesulfonamide [1S-(endo,endo)]-;
Benzenesulfonamide, N-{[(3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]hept-2-yl)amino]carbonyl}-4-methyl, [1S-(endo,endo)]-
Formula: C18H26N2O4S
Class: Therapeutics/Prescription Drugs
Glibornuride mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/2/2015 3:13:04 PM |
| InChI | InChI=1S/C18H26N2O4S/c1-11-5-7-12(8-6-11)25(23,24)20-16(22)19-14-13-9-10-18(4,15(14)21)17(13,2)3/h5-8,13-15,21H,9-10H2,1-4H3,(H2,19,20,22) |
| InChI Key | RMTYNAPTNBJHQI-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2C3CCC(C2O)(C3(C)C)C |
| CAS | 26944489 |
| Splash | |
| Other Names |
1-((1R)-2-Endo-hydroxy-3-endo-bornyl)-3-(p-tolylsulfonyl)urea; Urea, 1-(2-hydroxy-3-bornyl)-3-(p-tolylsulfonyl), (1R,2R,3S,4S)-; N-{[(3-Hydroxy-4,7,7-trimethylbicyclo[2.2.1]hept-2-yl)amino]carbonyl}-4-methylbenzenesulfonamide [1S-(endo,endo)]-; Benzenesulfonamide, N-{[(3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]hept-2-yl)amino]carbonyl}-4-methyl, [1S-(endo,endo)]- |
| Wikipedia | Glibornuride |
| ChemIDPlus | 026944489 |
| KEGG | D02427 |
| ChemSpider | 31034 |
| PubChem | 33649 |