Systematic / IUPAC Name: 3-Methyl-7H-purine-2,6-dione
ID: Reference217
Other Names:
2,6-Dihydroxy-3-methylpurine;
Xanthine, 3-methyl-;
3-Methyl-1H-purine-2,6(3H,7H)-dione;
3,7-Dihydro-3-methyl-1H-purine-2,6-dione;
1H-Purine-2,6-dione, 3,7-dihydro-3-methyl-
; more
Formula: C6H6N4O2
Class: Endogenous Metabolites
3-Methylxanthine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 921 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 11/21/2014 8:49:11 AM |
| InChI | InChI=1S/C6H6N4O2/c1-10-4-3(7-2-8-4)5(11)9-6(10)12/h2H,1H3,(H,7,8)(H,9,11,12) |
| InChI Key | GMSNIKWWOQHZGF-UHFFFAOYSA-N |
| Canonical SMILES | CN1C2=C(C(=O)NC1=O)NC=N2 |
| CAS | 1076228 |
| Splash | |
| Other Names |
2,6-Dihydroxy-3-methylpurine; Xanthine, 3-methyl-; 3-Methyl-1H-purine-2,6(3H,7H)-dione; 3,7-Dihydro-3-methyl-1H-purine-2,6-dione; 1H-Purine-2,6-dione, 3,7-dihydro-3-methyl-; 3-Methyl-3,9-dihydro-purine-2,6-dione; 3-Methyl-3,9-dihydro-1H-purine-2,6-dione; 3-Methyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione; 3-Methyl-1,3-dihydropurine-2,6-dione; 3-Methyl-3,7(9)-dihydro-purine-2,6-dione; 3,9-Dihydro-3-methyl-1H-purine-2,6-dione; 3-Methyl-3,9-dihydro-2H,6H-purine-2,6-dione; 3 MX |
| ChemSpider | 63805 |
| PubChem | 70639 |
| ChEMBL | CHEMBL619 |
| KEGG | C16357 |
| ChEBI | CHEBI:62207; CHEBI:62208 |
| HMDb | HMDB01886 |
| ChemIDPlus | 001076228 |