Systematic / IUPAC Name: [(8R,9S,10R,13S,14S,17S)-10,13-Dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate
ID: Reference2171
Other Names:
Deposteron;
Farmatest;
Testosterone 17-acetate;
Perandrone A;
Androtest A
; more
Formula: C21H30O3
Class: Sports Doping Drugs Endogenous Metabolites Steroids/Vitamins/Hormones Drugs of Abuse/Illegal Drugs
Testosterone acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/21/2015 7:37:55 AM |
| InChI | InChI=1S/C21H30O3/c1-13(22)24-19-7-6-17-16-5-4-14-12-15(23)8-10-20(14,2)18(16)9-11-21(17,19)3/h12,16-19H,4-11H2,1-3H3/t16-,17-,18-,19-,20-,21-/m0/s1 |
| InChI Key | DJPZSBANTAQNFN-PXQJOHHUSA-N |
| Canonical SMILES | CC(=O)OC1CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C |
| CAS | 1045698 |
| Splash | |
| Other Names |
Deposteron; Farmatest; Testosterone 17-acetate; Perandrone A; Androtest A; 17β-Acetoxy-4-androsten-3-one; 3-Oxoandrost-4-en-17β-yl acetate; Amolisin; 17β-Hydroxyandrost-4-en-3-one acetate; Aceto-sterandryl; Aceto-testoviron; Androst-4-en-17β-ol-3-one acetate; (17β)-Hydroxyandrost-4-en-3-one acetate; 4-Androsten-17β-ol-3-one 17-acetate; 17β-Hydroxy-4-androsten-3-one 17-acetate; 17β-Acetoxy-δ(4)-androstan-3-one; Androst-4-en-3-one, 17-(acetyloxy)-, (17β)- |
| ChemIDPlus | 001045698 |
| ChEMBL | CHEMBL488762 |
| ChemSpider | 83191 |
| ChEBI | CHEBI:16524 |
| KEGG | C03027 |
| PubChem | 92145 |