Systematic / IUPAC Name: Methyl N-(3,4-dichlorophenyl)carbamate
ID: Reference2192
Other Names:
Carbamic acid, (3,4-dichlorophenyl), methyl ester;
Methyl 3,4-dichlorocarbanilate;
Methyl 3,4-dichlorophenylcarbamate;
3,4-Dichlorocarbanilic acid methyl ester;
Carbanilic acid, 3,4-dichloro, methyl ester
; more
Formula: C8H7Cl2NO2
Class: Pesticides/Herbicides
Swep mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/21/2015 11:55:09 AM |
| InChI | InChI=1S/C8H7Cl2NO2/c1-13-8(12)11-5-2-3-6(9)7(10)4-5/h2-4H,1H3,(H,11,12) |
| InChI Key | WOZQBERUBLYCEG-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)NC1=CC(=C(C=C1)Cl)Cl |
| CAS | 1918189 |
| Splash | |
| Other Names |
Carbamic acid, (3,4-dichlorophenyl), methyl ester; Methyl 3,4-dichlorocarbanilate; Methyl 3,4-dichlorophenylcarbamate; 3,4-Dichlorocarbanilic acid methyl ester; Carbanilic acid, 3,4-dichloro, methyl ester; MCC; N-(3,4-Dichlorophenyl)methoxycarboxamide |
| KEGG | C19062 |
| PubChem | 15969 |
| ChemIDPlus | 001918189 |
| ChEMBL | CHEMBL1573885 |
| ChemSpider | 15173 |