Systematic / IUPAC Name: N-{2,4-Dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl]phenyl}methanesulfonamide
ID: Reference2201
Other Names:
Authority;
N-{2,4-Dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl}methanesulfonamide;
Methanesulfonamide, N-{2,4-dichloro-5-[4-(difluoromethyl)-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl}-
Formula: C11H10Cl2F2N4O3S
Class: Pesticides/Herbicides
Sulfentrazone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 8 |
| No. of Spectra | 1503 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 2/5/2015 9:43:08 AM |
| InChI | InChI=1S/C11H10Cl2F2N4O3S/c1-5-16-19(11(20)18(5)10(14)15)9-4-8(17-23(2,21)22)6(12)3-7(9)13/h3-4,10,17H,1-2H3 |
| InChI Key | OORLZFUTLGXMEF-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NN(C(=O)N1C(F)F)C2=CC(=C(C=C2Cl)Cl)NS(=O)(=O)C |
| CAS | 122836355 |
| Splash | |
| Other Names |
Authority; N-{2,4-Dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl}methanesulfonamide; Methanesulfonamide, N-{2,4-dichloro-5-[4-(difluoromethyl)-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl}- |
| Wikipedia | Sulfentrazone |
| ChemSpider | 77887 |
| ChemIDPlus | 122836355 |
| PubChem | 86369 |
| ChEMBL | CHEMBL1884669 |
| HMDb | HMDB34852 |
| KEGG | C11125 |