Systematic / IUPAC Name: 3-(Carbamoylamino)propanoic acid
ID: Reference221
Other Names:
Ureidopropionic acid;
β-Ureidopropionic acid;
N-(Aminocarbonyl)-β-alanine;
3-[(Aminocarbonyl)amino]propanoic acid;
β-Alanine, N-(aminocarbonyl)-
; more
Formula: C4H8N2O3
Class: Endogenous Metabolites
3-Ureidopropionic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 227 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2014 10:59:32 AM |
| InChI | InChI=1S/C4H8N2O3/c5-4(9)6-2-1-3(7)8/h1-2H2,(H,7,8)(H3,5,6,9) |
| InChI Key | JSJWCHRYRHKBBW-UHFFFAOYSA-N |
| Canonical SMILES | C(CNC(=O)N)C(=O)O |
| CAS | 462884 |
| Splash | |
| Other Names |
Ureidopropionic acid; β-Ureidopropionic acid; N-(Aminocarbonyl)-β-alanine; 3-[(Aminocarbonyl)amino]propanoic acid; β-Alanine, N-(aminocarbonyl)-; N-Carbamoyl-β-alanine; 3-Ureidopropionate; 3-Ureidopropanoic acid; Ureidopropionate; β-Ureidopropionate; N-Carbamyl-β-alanine; Propanoic acid, 3-ureido- |
| ChEMBL | CHEMBL20962 |
| Wikipedia | 3-Ureidopropionic acid |
| HMDb | HMDB00026 |
| PubChem | 111 |
| KEGG | C02642 |
| ChemSpider | 109 |
| ChEBI | CHEBI:18261 |
| ChemIDPlus | 000462884 |