Systematic / IUPAC Name: Methyl 2-{4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy}propanoate
ID: Reference2298
Other Names:
Quizalofop-methyl ester;
Propanoic acid, 2-{4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy}-, methyl ester;
Methyl 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate
Formula: C18H15ClN2O4
Class: Pesticides/Herbicides
Quizalofop-methyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/19/2015 3:19:14 PM |
| InChI | InChI=1S/C18H15ClN2O4/c1-11(18(22)23-2)24-13-4-6-14(7-5-13)25-17-10-20-16-9-12(19)3-8-15(16)21-17/h3-11H,1-2H3 |
| InChI Key | YGHJGQYNECSZDY-UHFFFAOYSA-N |
| Canonical SMILES | CC(C(=O)OC)OC1=CC=C(C=C1)OC2=CN=C3C=C(C=CC3=N2)Cl |
| CAS | |
| Splash | |
| Other Names |
Quizalofop-methyl ester; Propanoic acid, 2-{4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy}-, methyl ester; Methyl 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate |
| ChEMBL | CHEMBL51509 |
| ChemSpider | 162644 |
| PubChem | 187101 |
| ChemIDPlus | 076578137 |