Systematic / IUPAC Name: Methyl phenyl(2-piperidinyl)acetate
ID: Reference2313
Other Names:
Calocain;
Centedein;
Centredin;
Concerta ;
Daytrana
; more
Formula: C14H19NO2
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs Sports Doping Drugs
Methylphenidate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/16/2016 2:00:50 PM |
| InChI | InChI=1S/C14H19NO2/c1-17-14(16)13(11-7-3-2-4-8-11)12-9-5-6-10-15-12/h2-4,7-8,12-13,15H,5-6,9-10H2,1H3 |
| InChI Key | DUGOZIWVEXMGBE-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C(C1CCCCN1)C2=CC=CC=C2 |
| CAS | 113451 |
| Splash | |
| Other Names |
Calocain; Centedein; Centredin; Concerta ; Daytrana; Medikinet ; Meridil; Metadate; Metadate ER; Methypatch; NSC 169868 ; Phenidylate; Plimasine; Riphenidate; Ritalin SR; Ritaline; Ritcher works; α-Phenyl-α-(2-piperidyl)acetic acid methyl ester; α-Phenyl-2-piperidineacetic acid methyl ester; 2-Piperidineacetic acid, α-phenyl-, methyl ester; Methyl α-phenyl-α-(2-piperidyl)acetate; Methyl α-phenyl-α-2-piperidinylacetate; Methyl (2-phenyl-2-(2-piperidyl)acetate); Methyl 2-phenyl-2-(piperidin-2-yl)acetate; Methyl phenidate; Methyl phenidyl acetate; Methyl phenyl(piperidin-2-yl)acetate; Methylin; Methylin ER; Methylofenidan; Methylphen; Methylphenidan; Methylphenidatum; (+/-)-threo-Methylphenidate |
| ChEMBL | CHEMBL796 |
| DrugBank | DB00422 |
| ChEBI | CHEBI:6887 |
| KEGG | D04999; C07196 |
| PubChem | 4158 |
| Wikipedia | Methylphenidate |
| ChemSpider | 4015 |
| ChemIDPlus | 000113451 |