Systematic / IUPAC Name: 1-(2,6-Dimethylphenoxy)propan-2-amine
ID: Reference2376
Other Names:
2-Propanamine, 1-(2,6-dimethylphenoxy)-;
Mexilitine;
Ethylamine, 1-methyl-2-(2,6-xylyloxy)-;
1-Methyl-2-(2,6-xylyloxy)ethylamine;
1-(2,6-Dimethylphenoxy)-2-propanamine
; more
Formula: C11H17NO
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
Mexiletine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 94 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2015 8:24:30 AM |
| InChI | InChI=1S/C11H17NO/c1-8-5-4-6-9(2)11(8)13-7-10(3)12/h4-6,10H,7,12H2,1-3H3 |
| InChI Key | VLPIATFUUWWMKC-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=CC=C1)C)OCC(C)N |
| CAS | 31828714 |
| Splash | |
| Other Names |
2-Propanamine, 1-(2,6-dimethylphenoxy)-; Mexilitine; Ethylamine, 1-methyl-2-(2,6-xylyloxy)-; 1-Methyl-2-(2,6-xylyloxy)ethylamine; 1-(2,6-Dimethylphenoxy)-2-propanamine; 2-(2-Aminopropoxy)-1,3-dimethylbenzene; Ritalmex; 1-Methyl-2-(2,6-xylyloxy)ethanamine; Novo-mexiletine; Cirumimeru; Mequitolide; Metorekicin; Mekiratin; Meldest; Mexicord; Mexitilen; Minsetil; Mobalen; Mugadine; Olzoron; Poeruten; Tumetil; Melate; 1-(2,6-Dimethylphenoxy)prop-2-ylamine |
| DrugBank | DB00379 |
| Wikipedia | Mexiletine |
| KEGG | C07220; D08215 |
| ChemSpider | 4034 |
| ChemIDPlus | 031828714 |
| ChEBI | CHEBI:6916 |
| ChEMBL | CHEMBL558 |
| PubChem | 4178 |