Systematic / IUPAC Name: S-Ethyl 1-azepanecarbothioate
ID: Reference2390
Other Names:
Ordram;
S-Ethyl azepane-1-carbothioate;
Jalan;
Higalnate;
Molmate
; more
Formula: C9H17NOS
Class: Pesticides/Herbicides Industrial Chemicals
Molinate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 569 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 3/6/2015 3:00:15 PM |
| InChI | InChI=1S/C9H17NOS/c1-2-12-9(11)10-7-5-3-4-6-8-10/h2-8H2,1H3 |
| InChI Key | DEDOPGXGGQYYMW-UHFFFAOYSA-N |
| Canonical SMILES | CCSC(=O)N1CCCCCC1 |
| CAS | 2212671 |
| Splash | |
| Other Names |
Ordram; S-Ethyl azepane-1-carbothioate; Jalan; Higalnate; Molmate; Sakkimol; Hydram; Felan; Yalan; Yulan; 1H-Azepine-1-carbothioic acid, hexahydro-, S-ethyl ester; Malerbane giavoni L; S-Ethyl-N-hexamethylenethiocarbamate; S-Ethyl perhydroazepin-1-carbothioate; Ethyl 1-hexamethyleneiminecarbothiolate; S-Ethyl N,N-hexamethylenethiocarbamate; S-Ethyl hexahydroazepine-1-carbothioate; S-Ethyl 1-hexamethyleneiminothiocarbamate; S-Ethyl perhydroazepine-1-thiocarboxylate; S-Ethyl hexahydro-1H-azepine-1-carbothioate; S-Aethyl-N-hexahydro-1H-azepinthiolcarbamat; Molinate;1H-azepine-1 carbothioic acid hexahydro-S-ethyl ester |
| Wikipedia | Molinat (DE) |
| PubChem | 16653 |
| ChEMBL | CHEMBL1865916 |
| ChemSpider | 15790 |
| KEGG | C11086 |
| ChemIDPlus | 002212671 |