Systematic / IUPAC Name: 3-Chloro-4-(diethylamino)-4-oxo-2-buten-2-yl dimethyl phosphate
ID: Reference2400
Other Names:
Dimecron;
Phosphoric acid, 2-chloro-3-(diethylamino)-1-methyl-3-oxo-1-propenyl dimethyl ester;
Phosphoric acid, dimethyl ester, ester with 2-chloro-N,N-diethyl-3-hydroxycrotonamide;
Phosphamidone;
Apamidon
; more
Formula: C10H19ClNO5P
Class: Pesticides/Herbicides
Phosphamidon mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1841 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 3/9/2015 2:23:12 PM |
| InChI | InChI=1S/C10H19ClNO5P/c1-6-12(7-2)10(13)9(11)8(3)17-18(14,15-4)16-5/h6-7H2,1-5H3/b9-8- |
| InChI Key | RGCLLPNLLBQHPF-HJWRWDBZSA-N |
| Canonical SMILES | CCN(CC)C(=O)C(=C(C)OP(=O)(OC)OC)Cl |
| CAS | 13171216 |
| Splash | |
| Other Names |
Dimecron; Phosphoric acid, 2-chloro-3-(diethylamino)-1-methyl-3-oxo-1-propenyl dimethyl ester; Phosphoric acid, dimethyl ester, ester with 2-chloro-N,N-diethyl-3-hydroxycrotonamide; Phosphamidone; Apamidon; Famfos; Merkon; Dixon; 2-Chloro-N,N-diethyl-3-(dimethylphosphono)crotonic amide; 2-Chloro-3-dimethoxyphosphinoyloxy-N,N-diethylbut-2-enamide; O,O-Dimethyl O-(2-chloro-2-(N,N-diethylcarbamoyl)-1-methylvinyl) phosphate; Fosfamidon; Fosfamidone; Dimethyl diethylamido-1-chlorocrotonyl (2) phosphate; N,N-Diethyl 2-chloro-3-dimethylphosphate crotonamide; 2-Chloro-2-diethylcarbamoyl-1-methylvinyl dimethylphosphate; 2-Chloro-2-diethylcarbamyl-1-methylvinyl-dimethyl phosphate; Dimethyl 2-chloro-2-diethylcarbamoyl-1-methylvinyl phosphate; Crotonamide, 2-chloro-N,N-diethyl-3-hydroxy, dimethyl phosphate; (O,O-Dimethyl-O-(1-methyl-2-chloro-2-diethylcarbamoyl-vinyl) phosphate); 2-Chloro-3-(diethylamino)-1-methyl-3-oxo-1-propenyl dimethyl phosphate |
| ChEMBL | CHEMBL1892391 |
| ChemIDPlus | 013171216; 023783984 |
| KEGG | C18689 |
| ChemSpider | 2297538 |
| PubChem | 3032604 |
| Wikipedia | Phosphamidon |