Systematic / IUPAC Name: Diethyl 4-nitrophenyl phosphate
ID: Reference2451
Other Names:
Paraoxon-ethyl;
Phosphacol;
Diethyl p-nitrophenyl phosphate;
Phosphachole;
Chinorto
; more
Formula: C10H14NO6P
Class: Pesticides/Herbicides Endogenous Metabolites Therapeutics/Prescription Drugs
Paraoxon mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1994 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 8/4/2015 12:56:59 PM |
| InChI | InChI=1S/C10H14NO6P/c1-3-15-18(14,16-4-2)17-10-7-5-9(6-8-10)11(12)13/h5-8H,3-4H2,1-2H3 |
| InChI Key | WYMSBXTXOHUIGT-UHFFFAOYSA-N |
| Canonical SMILES | CCOP(=O)(OCC)OC1=CC=C(C=C1)[N+](=O)[O-] |
| CAS | 311455 |
| Splash | |
| Other Names |
Paraoxon-ethyl; Phosphacol; Diethyl p-nitrophenyl phosphate; Phosphachole; Chinorto; Fosfakol; Mintacol; Miotisal; Phosphakol; Ethyl paraoxon; Diethylparaoxon; Oxyparathion; Chinorta; Mintaco; Paraoxone; Paroxan; Eticol; Ethyl paraoxan; Phosphoric acid diethyl 4-nitrophenyl ester; Soluglacit; Soluglaucit; Mintisal; O,O-Diethyl O-p-nitrophenyl phosphate; Diethyl (4-nitrophenyl) phosphate; p-Nitrophenyl diethylphosphate; Phosphoric acid, diethyl p-nitrophenyl ester; O,O-Dietyl-O-p-nitrofenylfosfat; Ethyl p-nitrophenyl ethylphosphate; O,O-Diethyl phosphoric acid O-p-nitrophenyl ester; Phosphonothioic acid, diethylparanitrophenyl ester; 4-Nitrophenyl diethyl phosphate; O,O-Diethyl O-4-nitrophenyl phosphate |
| ChemSpider | 9026 |
| HMDb | HMDB13035 |
| Wikipedia | Paraoxon |
| ChEBI | CHEBI:27827 |
| ChEMBL | CHEMBL23838 |
| ChemIDPlus | 000311455 |
| PubChem | 9395 |
| KEGG | C06606 |