Systematic / IUPAC Name: 2,6-Difluorobenzoic acid
ID: Reference2518
Other Names: Benzoic acid, 2,6-difluoro-
Formula: C7H4F2O2
Class: Pesticides/Herbicides
Difluorobenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive HF Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 67 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/25/2015 9:23:35 AM |
| InChI | InChI=1S/C7H4F2O2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H,10,11) |
| InChI Key | ONOTYLMNTZNAQZ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C(=C1)F)C(=O)O)F |
| CAS | 385002 |
| Splash | |
| Other Names | Benzoic acid, 2,6-difluoro- |