Systematic / IUPAC Name: 16-Hydroxyhexadecanoic acid
ID: Reference2551
Other Names:
Juniperic acid;
16-Hydroxypalmitic acid;
Hexadecanoic acid, 16-hydroxy-;
ψ-Hydroxypalmitic acid;
Palmitic acid, 16-hydroxy-
Formula: C16H32O3
Class: Endogenous Metabolites
16-Hydroxyhexadecanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP ; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 6 |
| No. of Spectra | 1671 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 10/9/2017 8:55:18 AM |
| InChI | InChI=1S/C16H32O3/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h17H,1-15H2,(H,18,19) |
| InChI Key | UGAGPNKCDRTDHP-UHFFFAOYSA-N |
| Canonical SMILES | C(CCCCCCCC(=O)O)CCCCCCCO |
| CAS | 506138 |
| Splash | |
| Other Names |
Juniperic acid; 16-Hydroxypalmitic acid; Hexadecanoic acid, 16-hydroxy-; ψ-Hydroxypalmitic acid; Palmitic acid, 16-hydroxy- |
| ChEBI | CHEBI:55328 |
| LipidsMAPs | LMFA01050051 |
| KEGG | C18218 |
| ChemIDPlus | 000506138 |
| PubChem | 10466 |
| ChemSpider | 10034 |