Systematic / IUPAC Name: Pyridine-2,6-dicarboxylic acid
ID: Reference2578
Other Names:
2,6-Dipicolinic acid;
Dipicolinic acid;
2,6-Dicarboxypyridine
Formula: C7H5NO4
Class: Excipients/Additives/Colorants
2,6-Pyridinecarboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 7 |
| No. of Spectra | 1607 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 4/13/2015 9:10:27 AM |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h1-3H,(H,9,10)(H,11,12) |
| InChI Key | WJJMNDUMQPNECX-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=NC(=C1)C(=O)O)C(=O)O |
| CAS | 499832 |
| Splash | |
| Other Names |
2,6-Dipicolinic acid; Dipicolinic acid; 2,6-Dicarboxypyridine |
| PubChem | 10367 |
| HMDb | HMDB33161 |
| ChemSpider | 9940 |
| Wikipedia | Dipicolinic acid |
| ChemIDPlus | 000499832; 063450919; 004220171; 017956400 |
| ChEBI | CHEBI:46837 |
| DrugBank | DB04267 |