Systematic / IUPAC Name: 2-Bromo-4-fluorobenzoic acid
ID: Reference2588
Other Names:
4-Fluoro-2-bromobenzoic acid;
Benzoic acid, 2-bromo-4-fluoro-
Formula: C7H4BrFO2
2-Bromo-4-fluorobenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/15/2015 12:47:08 PM |
| InChI | InChI=1S/C7H4BrFO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,(H,10,11) |
| InChI Key | RRKPMLZRLKTDQV-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C=C1F)Br)C(=O)O |
| CAS | 1006413 |
| Splash | |
| Other Names |
4-Fluoro-2-bromobenzoic acid; Benzoic acid, 2-bromo-4-fluoro- |