Systematic / IUPAC Name: 3,4-Dimethylbenzoic acid
ID: Reference2597
Other Names:
Asym-o-xylylic acid;
1-Carboxy-3,4-dimethylbenzene;
Benzoic acid, 3,4-dimethyl-
Formula: C9H10O2
Class: Endogenous Metabolites Natural Products/Medicines Excipients/Additives/Colorants
3,4-Dimethylbenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 181 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/16/2015 1:12:09 PM |
| InChI | InChI=1S/C9H10O2/c1-6-3-4-8(9(10)11)5-7(6)2/h3-5H,1-2H3,(H,10,11) |
| InChI Key | OPVAJFQBSDUNQA-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=C(C=C1)C(=O)O)C |
| CAS | 619045 |
| Splash | |
| Other Names |
Asym-o-xylylic acid; 1-Carboxy-3,4-dimethylbenzene; Benzoic acid, 3,4-dimethyl- |
| ChemSpider | 11576 |
| ChEBI | CHEBI:64818 |
| HMDb | HMDB02237 |
| PubChem | 12073 |
| ChemIDPlus | 000619045 |