Systematic / IUPAC Name: (2S)-2-[(4-{[(6S)-2-Amino-5-methyl-4-oxo-1,6,7,8-tetrahydropteridin-6-yl]methylamino}benzoyl)amino]pentanedioic acid
ID: Reference262
Other Names:
5-Methyltetrahydrofolate;
[(6S)-5-Methyl-5,6,7,8-tetrahydropteroyl]glutamate;
N-(5-Methyl-5,6,7,8-tetrahydropteroyl)-L-glutamic acid;
5-Methyl-5,6,7,8-tetrahydrofolic acid;
Levomefolic acid
Formula: C20H25N7O6
Class: Endogenous Metabolites
5-Methyltetrahydrofolic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 422 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/11/2016 7:31:33 AM |
| InChI | InChI=1S/C20H25N7O6/c1-27-12(9-23-16-15(27)18(31)26-20(21)25-16)8-22-11-4-2-10(3-5-11)17(30)24-13(19(32)33)6-7-14(28)29/h2-5,12-13,22H,6-9H2,1H3,(H,24,30)(H,28,29)(H,32,33)(H4,21,23,25,26,31)/t12-,13-/m0/s1 |
| InChI Key | ZNOVTXRBGFNYRX-STQMWFEESA-N |
| Canonical SMILES | O=C(O)C(NC(=O)c1ccc(cc1)NCC3N(/C2=C(/N/C(=N\C2=O)N)NC3)C)CCC(=O)O |
| CAS | 134350 |
| Splash | |
| Other Names |
5-Methyltetrahydrofolate; [(6S)-5-Methyl-5,6,7,8-tetrahydropteroyl]glutamate; N-(5-Methyl-5,6,7,8-tetrahydropteroyl)-L-glutamic acid; 5-Methyl-5,6,7,8-tetrahydrofolic acid; Levomefolic acid; LMSR |
| PubChem | 444412 |
| ChEBI | CHEBI:15641 |
| Wikipedia | Levomefolic acid |
| KEGG | D09353 |
| ChEMBL | CHEMBL1231574 |
| ChemSpider | 392351 |