Systematic / IUPAC Name: Cyanomethyl N-methyl-N-phenylcarbamodithioate
ID: Reference2661
Other Names: 2-Cyanomethyl-N-methyl-N-phenyldithiocarbamate
Formula: C10H10N2S2
Class: Extractables/Leachables
Cyanomethyl methyl(phenyl)carbamodithioate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 236 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 3/16/2016 12:49:02 PM |
| InChI | InChI=1S/C10H10N2S2/c1-12(10(13)14-8-7-11)9-5-3-2-4-6-9/h2-6H,8H2,1H3 |
| InChI Key | FYACMHCOSCVNHO-UHFFFAOYSA-N |
| Canonical SMILES | CN(C1=CC=CC=C1)C(=S)SCC#N |
| CAS | 76926164 |
| Splash | |
| Other Names | 2-Cyanomethyl-N-methyl-N-phenyldithiocarbamate |