Systematic / IUPAC Name: Undecanoic acid
ID: Reference2682
Other Names:
n-Undecoic acid;
Undecoic acid;
n-Undecanoic acid;
n-Undecylic acid;
11-Undecanoic acid
; more
Formula: C11H22O2
Class: Extractables/Leachables Endogenous Metabolites Excipients/Additives/Colorants Personal Care Products/Cosmetics
Undecanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 392 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 6/2/2015 11:38:12 AM |
| InChI | InChI=1S/C11H22O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2,1H3,(H,12,13) |
| InChI Key | ZDPHROOEEOARMN-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCCCC(=O)O |
| CAS | 112378 |
| Splash | |
| Other Names |
n-Undecoic acid; Undecoic acid; n-Undecanoic acid; n-Undecylic acid; 11-Undecanoic acid; 1-Decanecarboxylic acid; 1-Undecanoic acid; Hendecanoic acid; Undecylic acid |
| ChemSpider | 7888 |
| KEGG | C17715 |
| HMDb | HMDB00947 |
| Wikipedia | Undecylic_acid |
| ChEBI | CHEBI:32368 |
| ChemIDPlus | 000112378; 073928004; 017265304; 014992202; 062916829 |
| PubChem | 8180 |
| LipidsMAPs | LMFA01010011 |