Systematic / IUPAC Name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Nonadecafluorodecanoic acid
ID: Reference2683
Other Names:
NDFDA ;
PFDA;
Decanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro-;
Decanoic acid, nonadecafluoro-;
Nonadecafluoro-n-decanoic acid
; more
Formula: C10HF19O2
Class: Extractables/Leachables Textile Chemicals/Auxiliary/Dyes Perfluorinated Hydrocarbons
Perfluorodecanoic acid (PFDA) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion; Orbitrap Fusion with FAIMS ; Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 902 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 3/29/2018 8:32:35 AM |
| InChI | InChI=1S/C10HF19O2/c11-2(12,1(30)31)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)29/h(H,30,31) |
| InChI Key | PCIUEQPBYFRTEM-UHFFFAOYSA-N |
| Canonical SMILES | C(=O)(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
| CAS | 335762 |
| Splash | |
| Other Names |
NDFDA ; PFDA; Decanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro-; Decanoic acid, nonadecafluoro-; Nonadecafluoro-n-decanoic acid; Nonadecafluorocapric acid; Nonadecafluorodecanoic acid; Perfluoro-n-decanoic acid; Perfluorocapric acid; Perfluorodecanoic acid |
| ChemIDPlus | 000335762 |
| ChemSpider | 9181 |
| PubChem | 9555 |
| ChEBI | CHEBI:35546 |