Systematic / IUPAC Name: Prop-2-enoic acid
ID: Reference2696
Other Names:
2-Propenoic acid;
Acroleic acid;
Antiprex A;
Aron;
Cyguard 266
; more
Formula: C3H4O2
Class: Extractables/Leachables Textile Chemicals/Auxiliary/Dyes Personal Care Products/Cosmetics Industrial Chemicals Endogenous Metabolites Excipients/Additives/Colorants
Acrylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 228 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/2/2015 12:46:17 PM |
| InChI | InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5) |
| InChI Key | NIXOWILDQLNWCW-UHFFFAOYSA-N |
| Canonical SMILES | C=CC(=O)O |
| CAS | 79107 |
| Splash | |
| Other Names |
2-Propenoic acid; Acroleic acid; Antiprex A; Aron; Cyguard 266; Dispex C40; Dow latex 354; Joncryl 678; Junlon 110; Jurimer AC 10P; Nalfloc 636; Primal ase 60; Propene acid; Propenoic acid; Rohagit SD 15; Versicol E 7; Versicol E15; Versicol E9; Versicol S 25; Versicol K 11; Viscalex HV 30; Viscon 103; Carboxyethylene; Ethylenecarboxylic acid; Revacryl A 191; Vinylformic acid |
| PubChem | 6581 |
| ChemSpider | 6333 |
| HMDb | HMDB31647 |
| Wikipedia | Acrylic acid |
| LipidsMAPs | LMFA01030193 |
| DrugBank | DB05384; DB02579 |
| ChemIDPlus | 000079107; 007446813; 009003014; 009003047; 009007209; 005651263; 005698986; 006292019; 009017689; 000867470 |
| ChEBI | CHEBI:18308 |
| KEGG | C00511; C19501; D03397; D03396; D03395; D03394; D03393; D03392 |